C21H28N4O — CID 109264341
[2-(2,6-diethylanilino)pyrimidin-5-yl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 109264341) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)pyrimidin-5-yl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [2-(2,6-diethylanilino)pyrimidin-5-yl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109264341 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | [2-(2,6-diethylanilino)pyrimidin-5-yl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CCc1cccc(CC)c1Nc1ncc(C(=O)N2CCCC(C)C2)cn1 |
| InChI | InChI=1S/C21H28N4O/c1-4-16-9-6-10-17(5-2)19(16)24-21-22-12-18(13-23-21)20(26)25-11-7-8-15(3)14-25/h6,9-10,12-13,15H,4-5,7-8,11,14H2,1-3H3,(H,22,23,24) |
| InChIKey | RIMUVVGDQOPHNS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |