C17H19FN4O — CID 109264391
[2-(3-fluoroanilino)pyrimidin-5-yl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 109264391) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is [2-(3-fluoroanilino)pyrimidin-5-yl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [2-(3-fluoroanilino)pyrimidin-5-yl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109264391 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | [2-(3-fluoroanilino)pyrimidin-5-yl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2cnc(Nc3cccc(F)c3)nc2)C1 |
| InChI | InChI=1S/C17H19FN4O/c1-12-4-3-7-22(11-12)16(23)13-9-19-17(20-10-13)21-15-6-2-5-14(18)8-15/h2,5-6,8-10,12H,3-4,7,11H2,1H3,(H,19,20,21) |
| InChIKey | PJFGCPBKMJNJRW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |