C22H39NO3 — CID 10926628
[(3R,4S,6S,9aS)-6-[(E,3S)-3-hydroxydec-1-enyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate (PubChem CID 10926628) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is [(3R,4S,6S,9aS)-6-[(E,3S)-3-hydroxydec-1-enyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate.
| Compound Name | [(3R,4S,6S,9aS)-6-[(E,3S)-3-hydroxydec-1-enyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate |
|---|---|
| PubChem CID | 10926628 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | [(3R,4S,6S,9aS)-6-[(E,3S)-3-hydroxydec-1-enyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate |
| SMILES | CCCCCCC[C@H](O)/C=C/[C@@H]1CCC[C@H]2CC[C@@H](OC(C)=O)[C@H](C)N21 |
| InChI | InChI=1S/C22H39NO3/c1-4-5-6-7-8-12-21(25)15-13-19-10-9-11-20-14-16-22(26-18(3)24)17(2)23(19)20/h13,15,17,19-22,25H,4-12,14,16H2,1-3H3/b15-13+/t17-,19-,20-,21-,22+/m0/s1 |
| InChIKey | ORNLZBLHCMORCF-WNBBTFJESA-N |
| XLogP | 4.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|