C23H41NO3 — CID 134887240
[(3R,4S,6S,9aS)-6-[(E,3S)-3-hydroxyundec-1-enyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate (PubChem CID 134887240) has the molecular formula C23H41NO3 and a molecular weight of 379.59 g/mol. Its IUPAC name is [(3R,4S,6S,9aS)-6-[(E,3S)-3-hydroxyundec-1-enyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate.
| Compound Name | [(3R,4S,6S,9aS)-6-[(E,3S)-3-hydroxyundec-1-enyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate |
|---|---|
| PubChem CID | 134887240 |
| Molecular Formula | C23H41NO3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | [(3R,4S,6S,9aS)-6-[(E,3S)-3-hydroxyundec-1-enyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate |
| SMILES | CCCCCCCC[C@H](O)/C=C/[C@@H]1CCC[C@H]2CC[C@@H](OC(C)=O)[C@H](C)N21 |
| InChI | InChI=1S/C23H41NO3/c1-4-5-6-7-8-9-13-22(26)16-14-20-11-10-12-21-15-17-23(27-19(3)25)18(2)24(20)21/h14,16,18,20-23,26H,4-13,15,17H2,1-3H3/b16-14+/t18-,20-,21-,22-,23+/m0/s1 |
| InChIKey | FIFLVZOIXOCTJD-JFLYUWHHSA-N |
| XLogP | 4.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|