C31H59NO3Si — CID 100996677
[(3R,4S,6S,9aS)-4-methyl-6-[(E,3S)-3-tri(propan-2-yl)silyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate (PubChem CID 100996677) has the molecular formula C31H59NO3Si and a molecular weight of 521.90 g/mol. Its IUPAC name is [(3R,4S,6S,9aS)-4-methyl-6-[(E,3S)-3-tri(propan-2-yl)silyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate.
| Compound Name | [(3R,4S,6S,9aS)-4-methyl-6-[(E,3S)-3-tri(propan-2-yl)silyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate |
|---|---|
| PubChem CID | 100996677 |
| Molecular Formula | C31H59NO3Si |
| Molecular Weight | 521.90 g/mol |
| Exact Mass | 521.43 |
| IUPAC Name | [(3R,4S,6S,9aS)-4-methyl-6-[(E,3S)-3-tri(propan-2-yl)silyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl] acetate |
| SMILES | CCCCCCC[C@@H](/C=C/[C@@H]1CCC[C@H]2CC[C@@H](OC(C)=O)[C@H](C)N21)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H59NO3Si/c1-10-11-12-13-14-18-30(35-36(23(2)3,24(4)5)25(6)7)21-19-28-16-15-17-29-20-22-31(34-27(9)33)26(8)32(28)29/h19,21,23-26,28-31H,10-18,20,22H2,1-9H3/b21-19+/t26-,28-,29-,30-,31+/m0/s1 |
| InChIKey | LVTWMNJEUHUNKV-HOKYTLPKSA-N |
| XLogP | 8.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.90 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|