C35H71NO2Si2 — CID 10793595
[(3R,4S,6R,9aS)-4-methyl-6-[(E)-4-triethylsilyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 10793595) has the molecular formula C35H71NO2Si2 and a molecular weight of 594.13 g/mol. Its IUPAC name is [(3R,4S,6R,9aS)-4-methyl-6-[(E)-4-triethylsilyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3R,4S,6R,9aS)-4-methyl-6-[(E)-4-triethylsilyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10793595 |
| Molecular Formula | C35H71NO2Si2 |
| Molecular Weight | 594.13 g/mol |
| Exact Mass | 593.50 |
| IUPAC Name | [(3R,4S,6R,9aS)-4-methyl-6-[(E)-4-triethylsilyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CCCCCCC(C/C=C/[C@H]1CCC[C@H]2CC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)N21)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C35H71NO2Si2/c1-12-16-17-18-24-34(37-39(13-2,14-3)15-4)25-20-23-32-21-19-22-33-26-27-35(31(11)36(32)33)38-40(28(5)6,29(7)8)30(9)10/h20,23,28-35H,12-19,21-22,24-27H2,1-11H3/b23-20+/t31-,32+,33-,34?,35+/m0/s1 |
| InChIKey | FWNGSUQDQRILCM-LXRAZZSLSA-N |
| XLogP | 11.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.13 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|