C29H55NOSi — CID 134980609
[(3R,4S,6S,9aS)-6-[(1E,3Z)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 134980609) has the molecular formula C29H55NOSi and a molecular weight of 461.85 g/mol. Its IUPAC name is [(3R,4S,6S,9aS)-6-[(1E,3Z)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3R,4S,6S,9aS)-6-[(1E,3Z)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134980609 |
| Molecular Formula | C29H55NOSi |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 461.41 |
| IUPAC Name | [(3R,4S,6S,9aS)-6-[(1E,3Z)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CCCCCC/C=C\C=C\[C@@H]1CCC[C@H]2CC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)N21 |
| InChI | InChI=1S/C29H55NOSi/c1-9-10-11-12-13-14-15-16-18-27-19-17-20-28-21-22-29(26(8)30(27)28)31-32(23(2)3,24(4)5)25(6)7/h14-16,18,23-29H,9-13,17,19-22H2,1-8H3/b15-14-,18-16+/t26-,27+,28-,29+/m0/s1 |
| InChIKey | WRUQZCJNGUVFMO-NWMCNMBTSA-N |
| XLogP | 9.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|