C26H49NOSi — CID 10550030
[(3R,4R,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-triethylsilane (PubChem CID 10550030) has the molecular formula C26H49NOSi and a molecular weight of 419.77 g/mol. Its IUPAC name is [(3R,4R,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-triethylsilane.
| Compound Name | [(3R,4R,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 10550030 |
| Molecular Formula | C26H49NOSi |
| Molecular Weight | 419.77 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | [(3R,4R,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-triethylsilane |
| SMILES | CCCCCC/C=C/C=C/C1CCC[C@H]2CC[C@@H](O[Si](CC)(CC)CC)[C@@H](C)N12 |
| InChI | InChI=1S/C26H49NOSi/c1-6-10-11-12-13-14-15-16-18-24-19-17-20-25-21-22-26(23(5)27(24)25)28-29(7-2,8-3)9-4/h14-16,18,23-26H,6-13,17,19-22H2,1-5H3/b15-14+,18-16+/t23-,24?,25+,26-/m1/s1 |
| InChIKey | KGPXMKHEOPSSDA-XWYVEIRLSA-N |
| XLogP | 7.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.77 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|