C22H43NOSi — CID 134999593
[(2R,3E,9aS)-3-heptylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane (PubChem CID 134999593) has the molecular formula C22H43NOSi and a molecular weight of 365.68 g/mol. Its IUPAC name is [(2R,3E,9aS)-3-heptylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane.
| Compound Name | [(2R,3E,9aS)-3-heptylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 134999593 |
| Molecular Formula | C22H43NOSi |
| Molecular Weight | 365.68 g/mol |
| Exact Mass | 365.31 |
| IUPAC Name | [(2R,3E,9aS)-3-heptylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane |
| SMILES | CCCCCC/C=C1\CN2CCCC[C@H]2C[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H43NOSi/c1-5-9-10-11-12-15-20-19-23-17-14-13-16-21(23)18-22(20)24-25(6-2,7-3)8-4/h15,21-22H,5-14,16-19H2,1-4H3/b20-15+/t21-,22+/m0/s1 |
| InChIKey | HGJNWZULDCNXJH-SGSLGHJISA-N |
| XLogP | 6.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.68 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|