C29H57NO2Si — CID 11049105
(3R,4S,6S,9aS)-4-methyl-6-[(E,3S)-3-tri(propan-2-yl)silyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol (PubChem CID 11049105) has the molecular formula C29H57NO2Si and a molecular weight of 479.87 g/mol. Its IUPAC name is (3R,4S,6S,9aS)-4-methyl-6-[(E,3S)-3-tri(propan-2-yl)silyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol.
| Compound Name | (3R,4S,6S,9aS)-4-methyl-6-[(E,3S)-3-tri(propan-2-yl)silyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol |
|---|---|
| PubChem CID | 11049105 |
| Molecular Formula | C29H57NO2Si |
| Molecular Weight | 479.87 g/mol |
| Exact Mass | 479.42 |
| IUPAC Name | (3R,4S,6S,9aS)-4-methyl-6-[(E,3S)-3-tri(propan-2-yl)silyloxydec-1-enyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol |
| SMILES | CCCCCCC[C@@H](/C=C/[C@@H]1CCC[C@H]2CC[C@@H](O)[C@H](C)N21)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H57NO2Si/c1-9-10-11-12-13-17-28(32-33(22(2)3,23(4)5)24(6)7)20-18-26-15-14-16-27-19-21-29(31)25(8)30(26)27/h18,20,22-29,31H,9-17,19,21H2,1-8H3/b20-18+/t25-,26-,27-,28-,29+/m0/s1 |
| InChIKey | LPMMCNOXWSRXJB-RQZIGLHBSA-N |
| XLogP | 8.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.87 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|