C20H41NOSi2 — CID 10499228
[(2E)-2-[(2R,9aS)-2-triethylsilyloxy-1,2,4,6,7,8,9,9a-octahydroquinolizin-3-ylidene]ethyl]-trimethylsilane (PubChem CID 10499228) has the molecular formula C20H41NOSi2 and a molecular weight of 367.73 g/mol. Its IUPAC name is [(2E)-2-[(2R,9aS)-2-triethylsilyloxy-1,2,4,6,7,8,9,9a-octahydroquinolizin-3-ylidene]ethyl]-trimethylsilane.
| Compound Name | [(2E)-2-[(2R,9aS)-2-triethylsilyloxy-1,2,4,6,7,8,9,9a-octahydroquinolizin-3-ylidene]ethyl]-trimethylsilane |
|---|---|
| PubChem CID | 10499228 |
| Molecular Formula | C20H41NOSi2 |
| Molecular Weight | 367.73 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | [(2E)-2-[(2R,9aS)-2-triethylsilyloxy-1,2,4,6,7,8,9,9a-octahydroquinolizin-3-ylidene]ethyl]-trimethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@@H]2CCCCN2C/C1=C\C[Si](C)(C)C |
| InChI | InChI=1S/C20H41NOSi2/c1-7-24(8-2,9-3)22-20-16-19-12-10-11-14-21(19)17-18(20)13-15-23(4,5)6/h13,19-20H,7-12,14-17H2,1-6H3/b18-13+/t19-,20+/m0/s1 |
| InChIKey | ACYROLGLSJTPED-HHBVSCPVSA-N |
| XLogP | 5.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.73 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|