C19H39NOSi2 — CID 100937501
[(E)-[(2R,9aS)-2-triethylsilyloxy-1,2,4,6,7,8,9,9a-octahydroquinolizin-3-ylidene]methyl]-trimethylsilane (PubChem CID 100937501) has the molecular formula C19H39NOSi2 and a molecular weight of 353.70 g/mol. Its IUPAC name is [(E)-[(2R,9aS)-2-triethylsilyloxy-1,2,4,6,7,8,9,9a-octahydroquinolizin-3-ylidene]methyl]-trimethylsilane.
| Compound Name | [(E)-[(2R,9aS)-2-triethylsilyloxy-1,2,4,6,7,8,9,9a-octahydroquinolizin-3-ylidene]methyl]-trimethylsilane |
|---|---|
| PubChem CID | 100937501 |
| Molecular Formula | C19H39NOSi2 |
| Molecular Weight | 353.70 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | [(E)-[(2R,9aS)-2-triethylsilyloxy-1,2,4,6,7,8,9,9a-octahydroquinolizin-3-ylidene]methyl]-trimethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@@H]2CCCCN2C/C1=C\[Si](C)(C)C |
| InChI | InChI=1S/C19H39NOSi2/c1-7-23(8-2,9-3)21-19-14-18-12-10-11-13-20(18)15-17(19)16-22(4,5)6/h16,18-19H,7-15H2,1-6H3/b17-16+/t18-,19+/m0/s1 |
| InChIKey | LKVVFPSCMNKVQH-YESYDRAFSA-N |
| XLogP | 5.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|