C16H31NOSi — CID 101066587
[(2S,9aS)-3-methylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane (PubChem CID 101066587) has the molecular formula C16H31NOSi and a molecular weight of 281.52 g/mol. Its IUPAC name is [(2S,9aS)-3-methylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane.
| Compound Name | [(2S,9aS)-3-methylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 101066587 |
| Molecular Formula | C16H31NOSi |
| Molecular Weight | 281.52 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | [(2S,9aS)-3-methylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane |
| SMILES | C=C1CN2CCCC[C@H]2C[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H31NOSi/c1-5-19(6-2,7-3)18-16-12-15-10-8-9-11-17(15)13-14(16)4/h15-16H,4-13H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | WEYFWCUGBQAUKQ-HOTGVXAUSA-N |
| XLogP | 4.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|