C26H49NOSi — CID 11847548
[(3R,4S,6S,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11847548) has the molecular formula C26H49NOSi and a molecular weight of 419.77 g/mol. Its IUPAC name is [(3R,4S,6S,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,4S,6S,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11847548 |
| Molecular Formula | C26H49NOSi |
| Molecular Weight | 419.77 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | [(3R,4S,6S,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCCC/C=C/C=C/[C@@H]1CCC[C@H]2CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)N21 |
| InChI | InChI=1S/C26H49NOSi/c1-8-9-10-11-12-13-14-15-17-23-18-16-19-24-20-21-25(22(2)27(23)24)28-29(6,7)26(3,4)5/h13-15,17,22-25H,8-12,16,18-21H2,1-7H3/b14-13+,17-15+/t22-,23+,24-,25+/m0/s1 |
| InChIKey | VWNDEXABWZXMEF-CCDAHKFXSA-N |
| XLogP | 7.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.77 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|