C17H10Cl2F2N4O — CID 109270657
N-(2,3-dichlorophenyl)-2-(2,6-difluoroanilino)pyrimidine-5-carboxamide (PubChem CID 109270657) has the molecular formula C17H10Cl2F2N4O and a molecular weight of 395.20 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(2,6-difluoroanilino)pyrimidine-5-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(2,6-difluoroanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109270657 |
| Molecular Formula | C17H10Cl2F2N4O |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(2,6-difluoroanilino)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1cnc(Nc2c(F)cccc2F)nc1 |
| InChI | InChI=1S/C17H10Cl2F2N4O/c18-10-3-1-6-13(14(10)19)24-16(26)9-7-22-17(23-8-9)25-15-11(20)4-2-5-12(15)21/h1-8H,(H,24,26)(H,22,23,25) |
| InChIKey | DTWDJRSNEXUTEI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |