C19H32OSeSi — CID 10927088
tert-butyl-dimethyl-[(Z)-7-phenylselanylhept-2-en-2-yl]oxysilane (PubChem CID 10927088) has the molecular formula C19H32OSeSi and a molecular weight of 383.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-7-phenylselanylhept-2-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(Z)-7-phenylselanylhept-2-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 10927088 |
| Molecular Formula | C19H32OSeSi |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-7-phenylselanylhept-2-en-2-yl]oxysilane |
| SMILES | C/C(=C/CCCC[Se]c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32OSeSi/c1-17(20-22(5,6)19(2,3)4)13-9-8-12-16-21-18-14-10-7-11-15-18/h7,10-11,13-15H,8-9,12,16H2,1-6H3/b17-13- |
| InChIKey | CHTYOEKLWJZPQJ-LGMDPLHJSA-N |
| XLogP | 5.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|