C20H29NO5S — CID 10927362
[2-[(S)-(4-methylphenyl)sulfinyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate (PubChem CID 10927362) has the molecular formula C20H29NO5S and a molecular weight of 395.52 g/mol. Its IUPAC name is [2-[(S)-(4-methylphenyl)sulfinyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate.
| Compound Name | [2-[(S)-(4-methylphenyl)sulfinyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 10927362 |
| Molecular Formula | C20H29NO5S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [2-[(S)-(4-methylphenyl)sulfinyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-en-3-yl] acetate |
| SMILES | C=C(C(CCCNC(=O)OC(C)(C)C)OC(C)=O)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H29NO5S/c1-14-9-11-17(12-10-14)27(24)15(2)18(25-16(3)22)8-7-13-21-19(23)26-20(4,5)6/h9-12,18H,2,7-8,13H2,1,3-6H3,(H,21,23)/t18?,27-/m1/s1 |
| InChIKey | BHSYKOXEGAHFIP-MKAWVKDUSA-N |
| XLogP | 3.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|