C20H18F2N4O — CID 109281677
N-[2-(2-fluorophenyl)ethyl]-5-[(4-fluorophenyl)methylamino]pyrazine-2-carboxamide (PubChem CID 109281677) has the molecular formula C20H18F2N4O and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-5-[(4-fluorophenyl)methylamino]pyrazine-2-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-5-[(4-fluorophenyl)methylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109281677 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-5-[(4-fluorophenyl)methylamino]pyrazine-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)c1cnc(NCc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C20H18F2N4O/c21-16-7-5-14(6-8-16)11-25-19-13-24-18(12-26-19)20(27)23-10-9-15-3-1-2-4-17(15)22/h1-8,12-13H,9-11H2,(H,23,27)(H,25,26) |
| InChIKey | NTEAGTHAFOYWEO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |