C22H37ClO7 — CID 10928450
[(7S,8S)-7,8-diacetyloxy-16-chloro-16-oxohexadecyl] acetate (PubChem CID 10928450) has the molecular formula C22H37ClO7 and a molecular weight of 448.98 g/mol. Its IUPAC name is [(7S,8S)-7,8-diacetyloxy-16-chloro-16-oxohexadecyl] acetate.
| Compound Name | [(7S,8S)-7,8-diacetyloxy-16-chloro-16-oxohexadecyl] acetate |
|---|---|
| PubChem CID | 10928450 |
| Molecular Formula | C22H37ClO7 |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | [(7S,8S)-7,8-diacetyloxy-16-chloro-16-oxohexadecyl] acetate |
| SMILES | CC(=O)OCCCCCC[C@H](OC(C)=O)[C@H](CCCCCCCC(=O)Cl)OC(C)=O |
| InChI | InChI=1S/C22H37ClO7/c1-17(24)28-16-12-8-7-10-14-21(30-19(3)26)20(29-18(2)25)13-9-5-4-6-11-15-22(23)27/h20-21H,4-16H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | JPEZQMSDIRCZCZ-SFTDATJTSA-N |
| XLogP | 4.86 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|