C25H26N2O5S — CID 10928741
N-[(R)-[(3R,6S,7aS)-3-methyl-5-oxo-3-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl]-(furan-2-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 10928741) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[(R)-[(3R,6S,7aS)-3-methyl-5-oxo-3-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl]-(furan-2-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(R)-[(3R,6S,7aS)-3-methyl-5-oxo-3-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl]-(furan-2-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10928741 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-[(R)-[(3R,6S,7aS)-3-methyl-5-oxo-3-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl]-(furan-2-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](c2ccco2)[C@@H]2C[C@H]3CO[C@](C)(c4ccccc4)N3C2=O)cc1 |
| InChI | InChI=1S/C25H26N2O5S/c1-17-10-12-20(13-11-17)33(29,30)26-23(22-9-6-14-31-22)21-15-19-16-32-25(2,27(19)24(21)28)18-7-4-3-5-8-18/h3-14,19,21,23,26H,15-16H2,1-2H3/t19-,21-,23+,25+/m0/s1 |
| InChIKey | UEYLUVYPARMLJQ-FEGXGRLVSA-N |
| XLogP | 3.73 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |