C21H28N4O — CID 109288815
N-(2,6-diethylphenyl)-5-(3-methylpiperidin-1-yl)pyrazine-2-carboxamide (PubChem CID 109288815) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-5-(3-methylpiperidin-1-yl)pyrazine-2-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-5-(3-methylpiperidin-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109288815 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-(2,6-diethylphenyl)-5-(3-methylpiperidin-1-yl)pyrazine-2-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1cnc(N2CCCC(C)C2)cn1 |
| InChI | InChI=1S/C21H28N4O/c1-4-16-9-6-10-17(5-2)20(16)24-21(26)18-12-23-19(13-22-18)25-11-7-8-15(3)14-25/h6,9-10,12-13,15H,4-5,7-8,11,14H2,1-3H3,(H,24,26) |
| InChIKey | PRTXUJROLCPDLL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |