C18H21ClN4O — CID 109288825
N-(5-chloro-2-methylphenyl)-5-(3-methylpiperidin-1-yl)pyrazine-2-carboxamide (PubChem CID 109288825) has the molecular formula C18H21ClN4O and a molecular weight of 344.85 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-5-(3-methylpiperidin-1-yl)pyrazine-2-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-5-(3-methylpiperidin-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109288825 |
| Molecular Formula | C18H21ClN4O |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-5-(3-methylpiperidin-1-yl)pyrazine-2-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)c1cnc(N2CCCC(C)C2)cn1 |
| InChI | InChI=1S/C18H21ClN4O/c1-12-4-3-7-23(11-12)17-10-20-16(9-21-17)18(24)22-15-8-14(19)6-5-13(15)2/h5-6,8-10,12H,3-4,7,11H2,1-2H3,(H,22,24) |
| InChIKey | UBCTVEULLXKGTQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |