C22H28N2O6S2 — CID 10928924
(2R,3R)-N-hydroxy-3-[(1R)-1-hydroxy-2-phenylsulfanylethyl]-1-(4-methoxyphenyl)sulfonyl-4,4-dimethylpyrrolidine-2-carboxamide (PubChem CID 10928924) has the molecular formula C22H28N2O6S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is (2R,3R)-N-hydroxy-3-[(1R)-1-hydroxy-2-phenylsulfanylethyl]-1-(4-methoxyphenyl)sulfonyl-4,4-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2R,3R)-N-hydroxy-3-[(1R)-1-hydroxy-2-phenylsulfanylethyl]-1-(4-methoxyphenyl)sulfonyl-4,4-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10928924 |
| Molecular Formula | C22H28N2O6S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | (2R,3R)-N-hydroxy-3-[(1R)-1-hydroxy-2-phenylsulfanylethyl]-1-(4-methoxyphenyl)sulfonyl-4,4-dimethylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C)(C)[C@@H]([C@@H](O)CSc3ccccc3)[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C22H28N2O6S2/c1-22(2)14-24(32(28,29)17-11-9-15(30-3)10-12-17)20(21(26)23-27)19(22)18(25)13-31-16-7-5-4-6-8-16/h4-12,18-20,25,27H,13-14H2,1-3H3,(H,23,26)/t18-,19-,20+/m0/s1 |
| InChIKey | ZPNXAVJYHSAOKF-SLFFLAALSA-N |
| XLogP | 2.37 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|