C23H24N2O5S3 — CID 139966455
(4R,5R)-N-hydroxy-6-(4-methoxyphenyl)sulfonyl-4-(phenylsulfanylmethyl)-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide (PubChem CID 139966455) has the molecular formula C23H24N2O5S3 and a molecular weight of 504.66 g/mol. Its IUPAC name is (4R,5R)-N-hydroxy-6-(4-methoxyphenyl)sulfonyl-4-(phenylsulfanylmethyl)-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide.
| Compound Name | (4R,5R)-N-hydroxy-6-(4-methoxyphenyl)sulfonyl-4-(phenylsulfanylmethyl)-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide |
|---|---|
| PubChem CID | 139966455 |
| Molecular Formula | C23H24N2O5S3 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | (4R,5R)-N-hydroxy-6-(4-methoxyphenyl)sulfonyl-4-(phenylsulfanylmethyl)-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCc3sccc3[C@@H](CSc3ccccc3)[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C23H24N2O5S3/c1-30-16-7-9-18(10-8-16)33(28,29)25-13-11-21-19(12-14-31-21)20(22(25)23(26)24-27)15-32-17-5-3-2-4-6-17/h2-10,12,14,20,22,27H,11,13,15H2,1H3,(H,24,26)/t20-,22-/m1/s1 |
| InChIKey | HRQULIBLCJYLJD-IFMALSPDSA-N |
| XLogP | 3.75 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|