C20H25NO6S2 — CID 139966453
methyl (4R,5S)-4-(2-methoxyethyl)-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate (PubChem CID 139966453) has the molecular formula C20H25NO6S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is methyl (4R,5S)-4-(2-methoxyethyl)-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate.
| Compound Name | methyl (4R,5S)-4-(2-methoxyethyl)-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate |
|---|---|
| PubChem CID | 139966453 |
| Molecular Formula | C20H25NO6S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | methyl (4R,5S)-4-(2-methoxyethyl)-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate |
| SMILES | COCC[C@@H]1c2ccsc2CCN(S(=O)(=O)c2ccc(OC)cc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C20H25NO6S2/c1-25-12-9-17-16-10-13-28-18(16)8-11-21(19(17)20(22)27-3)29(23,24)15-6-4-14(26-2)5-7-15/h4-7,10,13,17,19H,8-9,11-12H2,1-3H3/t17-,19+/m1/s1 |
| InChIKey | VSABODWMCCCETC-MJGOQNOKSA-N |
| XLogP | 2.67 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |