C26H29NO5S2 — CID 139966482
methyl (5R,6R)-7-(4-methoxyphenyl)sulfonyl-5-(2-phenylethyl)-5,6,8,9-tetrahydro-4H-thieno[2,3-d]azocine-6-carboxylate (PubChem CID 139966482) has the molecular formula C26H29NO5S2 and a molecular weight of 499.65 g/mol. Its IUPAC name is methyl (5R,6R)-7-(4-methoxyphenyl)sulfonyl-5-(2-phenylethyl)-5,6,8,9-tetrahydro-4H-thieno[2,3-d]azocine-6-carboxylate.
| Compound Name | methyl (5R,6R)-7-(4-methoxyphenyl)sulfonyl-5-(2-phenylethyl)-5,6,8,9-tetrahydro-4H-thieno[2,3-d]azocine-6-carboxylate |
|---|---|
| PubChem CID | 139966482 |
| Molecular Formula | C26H29NO5S2 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | methyl (5R,6R)-7-(4-methoxyphenyl)sulfonyl-5-(2-phenylethyl)-5,6,8,9-tetrahydro-4H-thieno[2,3-d]azocine-6-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](CCc2ccccc2)Cc2ccsc2CCN1S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H29NO5S2/c1-31-22-10-12-23(13-11-22)34(29,30)27-16-14-24-20(15-17-33-24)18-21(25(27)26(28)32-2)9-8-19-6-4-3-5-7-19/h3-7,10-13,15,17,21,25H,8-9,14,16,18H2,1-2H3/t21-,25-/m1/s1 |
| InChIKey | XSRBUIUEIURGII-PXDATVDWSA-N |
| XLogP | 4.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |