C16H18N2O6S2 — CID 20577813
N,4-dihydroxy-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide (PubChem CID 20577813) has the molecular formula C16H18N2O6S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is N,4-dihydroxy-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide.
| Compound Name | N,4-dihydroxy-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide |
|---|---|
| PubChem CID | 20577813 |
| Molecular Formula | C16H18N2O6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N,4-dihydroxy-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCc3sccc3C(O)C2C(=O)NO)cc1 |
| InChI | InChI=1S/C16H18N2O6S2/c1-24-10-2-4-11(5-3-10)26(22,23)18-8-6-13-12(7-9-25-13)15(19)14(18)16(20)17-21/h2-5,7,9,14-15,19,21H,6,8H2,1H3,(H,17,20) |
| InChIKey | VDPKHAXQMDJEII-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|