C19H21NO5S2 — CID 57030008
methyl (4S,5S)-4-ethenyl-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate (PubChem CID 57030008) has the molecular formula C19H21NO5S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is methyl (4S,5S)-4-ethenyl-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate.
| Compound Name | methyl (4S,5S)-4-ethenyl-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate |
|---|---|
| PubChem CID | 57030008 |
| Molecular Formula | C19H21NO5S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | methyl (4S,5S)-4-ethenyl-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate |
| SMILES | C=C[C@H]1c2ccsc2CCN(S(=O)(=O)c2ccc(OC)cc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C19H21NO5S2/c1-4-15-16-10-12-26-17(16)9-11-20(18(15)19(21)25-3)27(22,23)14-7-5-13(24-2)6-8-14/h4-8,10,12,15,18H,1,9,11H2,2-3H3/t15-,18-/m0/s1 |
| InChIKey | KBCWQOMVLJVJSR-YJBOKZPZSA-N |
| XLogP | 2.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|