C23H23BrN2O5S2 — CID 57016021
(4S,5S)-4-[(4-bromophenyl)methyl]-N-hydroxy-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide (PubChem CID 57016021) has the molecular formula C23H23BrN2O5S2 and a molecular weight of 551.48 g/mol. Its IUPAC name is (4S,5S)-4-[(4-bromophenyl)methyl]-N-hydroxy-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide.
| Compound Name | (4S,5S)-4-[(4-bromophenyl)methyl]-N-hydroxy-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide |
|---|---|
| PubChem CID | 57016021 |
| Molecular Formula | C23H23BrN2O5S2 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | (4S,5S)-4-[(4-bromophenyl)methyl]-N-hydroxy-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCc3sccc3[C@H](Cc3ccc(Br)cc3)[C@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C23H23BrN2O5S2/c1-31-17-6-8-18(9-7-17)33(29,30)26-12-10-21-19(11-13-32-21)20(22(26)23(27)25-28)14-15-2-4-16(24)5-3-15/h2-9,11,13,20,22,28H,10,12,14H2,1H3,(H,25,27)/t20-,22-/m0/s1 |
| InChIKey | ADIFJFHYZCNDSS-UNMCSNQZSA-N |
| XLogP | 3.97 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|