C22H29NO5S2 — CID 57051372
methyl (4S,5S)-6-(4-methoxyphenyl)sulfonyl-4-(3-methylbutyl)-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate (PubChem CID 57051372) has the molecular formula C22H29NO5S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is methyl (4S,5S)-6-(4-methoxyphenyl)sulfonyl-4-(3-methylbutyl)-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate.
| Compound Name | methyl (4S,5S)-6-(4-methoxyphenyl)sulfonyl-4-(3-methylbutyl)-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate |
|---|---|
| PubChem CID | 57051372 |
| Molecular Formula | C22H29NO5S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | methyl (4S,5S)-6-(4-methoxyphenyl)sulfonyl-4-(3-methylbutyl)-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](CCC(C)C)c2ccsc2CCN1S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H29NO5S2/c1-15(2)5-10-19-18-12-14-29-20(18)11-13-23(21(19)22(24)28-4)30(25,26)17-8-6-16(27-3)7-9-17/h6-9,12,14-15,19,21H,5,10-11,13H2,1-4H3/t19-,21-/m0/s1 |
| InChIKey | NMFAXFWYDGTFPS-FPOVZHCZSA-N |
| XLogP | 4.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |