C28H56N2O9 — CID 10929804
(2R,3S,4S,5R,6R)-2-[(2-ethylhexylamino)methyl]-6-[(2R,3R,4S,5S,6R)-6-[(2-ethylhexylamino)methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol (PubChem CID 10929804) has the molecular formula C28H56N2O9 and a molecular weight of 564.76 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-[(2-ethylhexylamino)methyl]-6-[(2R,3R,4S,5S,6R)-6-[(2-ethylhexylamino)methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-[(2-ethylhexylamino)methyl]-6-[(2R,3R,4S,5S,6R)-6-[(2-ethylhexylamino)methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 10929804 |
| Molecular Formula | C28H56N2O9 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-[(2-ethylhexylamino)methyl]-6-[(2R,3R,4S,5S,6R)-6-[(2-ethylhexylamino)methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | CCCCC(CC)CNC[C@H]1O[C@H](O[C@H]2O[C@H](CNCC(CC)CCCC)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H56N2O9/c1-5-9-11-17(7-3)13-29-15-19-21(31)23(33)25(35)27(37-19)39-28-26(36)24(34)22(32)20(38-28)16-30-14-18(8-4)12-10-6-2/h17-36H,5-16H2,1-4H3/t17?,18?,19-,20-,21-,22-,23+,24+,25-,26-,27-,28-/m1/s1 |
| InChIKey | QTSMUCCUYQKHBB-KMCZWAEOSA-N |
| XLogP | 0.23 |
| TPSA | 173.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |