C17H25N5O3 — CID 109320089
ethyl 4-[[6-methyl-2-(prop-2-enylamino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 109320089) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is ethyl 4-[[6-methyl-2-(prop-2-enylamino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-methyl-2-(prop-2-enylamino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109320089 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | ethyl 4-[[6-methyl-2-(prop-2-enylamino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | C=CCNc1nc(C)cc(C(=O)NC2CCN(C(=O)OCC)CC2)n1 |
| InChI | InChI=1S/C17H25N5O3/c1-4-8-18-16-19-12(3)11-14(21-16)15(23)20-13-6-9-22(10-7-13)17(24)25-5-2/h4,11,13H,1,5-10H2,2-3H3,(H,20,23)(H,18,19,21) |
| InChIKey | ZXZJQHIEGAXTSC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|