C12H14N2 — CID 10932162
1,3-dimethyl-2-prop-2-enylpyrrolo[3,2-c]pyridine (PubChem CID 10932162) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1,3-dimethyl-2-prop-2-enylpyrrolo[3,2-c]pyridine.
| Compound Name | 1,3-dimethyl-2-prop-2-enylpyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 10932162 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1,3-dimethyl-2-prop-2-enylpyrrolo[3,2-c]pyridine |
| SMILES | C=CCc1c(C)c2cnccc2n1C |
| InChI | InChI=1S/C12H14N2/c1-4-5-11-9(2)10-8-13-7-6-12(10)14(11)3/h4,6-8H,1,5H2,2-3H3 |
| InChIKey | OPSZWCHQNWWBBX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|