C9H20LiNSi2 — CID 10932629
lithium N,N-bis(trimethylsilyl)prop-2-yn-1-amine (PubChem CID 10932629) has the molecular formula C9H20LiNSi2 and a molecular weight of 205.38 g/mol. Its IUPAC name is lithium N,N-bis(trimethylsilyl)prop-2-yn-1-amine.
| Compound Name | lithium N,N-bis(trimethylsilyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 10932629 |
| Molecular Formula | C9H20LiNSi2 |
| Molecular Weight | 205.38 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | lithium N,N-bis(trimethylsilyl)prop-2-yn-1-amine |
| SMILES | [C-]#CCN([Si](C)(C)C)[Si](C)(C)C.[Li+] |
| InChI | InChI=1S/C9H20NSi2.Li/c1-8-9-10(11(2,3)4)12(5,6)7;/h9H2,2-7H3;/q-1;+1 |
| InChIKey | KPQOZOPAQGFWHZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.38 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|