C14H31NSi2 — CID 13332922
N,N-bis(trimethylsilyl)oct-2-yn-1-amine (PubChem CID 13332922) has the molecular formula C14H31NSi2 and a molecular weight of 269.58 g/mol. Its IUPAC name is N,N-bis(trimethylsilyl)oct-2-yn-1-amine.
| Compound Name | N,N-bis(trimethylsilyl)oct-2-yn-1-amine |
|---|---|
| PubChem CID | 13332922 |
| Molecular Formula | C14H31NSi2 |
| Molecular Weight | 269.58 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N,N-bis(trimethylsilyl)oct-2-yn-1-amine |
| SMILES | CCCCCC#CCN([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H31NSi2/c1-8-9-10-11-12-13-14-15(16(2,3)4)17(5,6)7/h8-11,14H2,1-7H3 |
| InChIKey | OZLYTHJXHMZYEX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|