C10H23NSi2 — CID 13161116
N,N-bis(trimethylsilyl)but-2-yn-1-amine (PubChem CID 13161116) has the molecular formula C10H23NSi2 and a molecular weight of 213.47 g/mol. Its IUPAC name is N,N-bis(trimethylsilyl)but-2-yn-1-amine.
| Compound Name | N,N-bis(trimethylsilyl)but-2-yn-1-amine |
|---|---|
| PubChem CID | 13161116 |
| Molecular Formula | C10H23NSi2 |
| Molecular Weight | 213.47 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | N,N-bis(trimethylsilyl)but-2-yn-1-amine |
| SMILES | CC#CCN([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C10H23NSi2/c1-8-9-10-11(12(2,3)4)13(5,6)7/h10H2,1-7H3 |
| InChIKey | FQWAFATVXDFRKS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|