C20H17F3N4O — CID 109328414
N-benzyl-N,6-dimethyl-2-(2,3,4-trifluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109328414) has the molecular formula C20H17F3N4O and a molecular weight of 386.38 g/mol. Its IUPAC name is N-benzyl-N,6-dimethyl-2-(2,3,4-trifluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-benzyl-N,6-dimethyl-2-(2,3,4-trifluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109328414 |
| Molecular Formula | C20H17F3N4O |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-benzyl-N,6-dimethyl-2-(2,3,4-trifluoroanilino)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)Cc2ccccc2)nc(Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C20H17F3N4O/c1-12-10-16(19(28)27(2)11-13-6-4-3-5-7-13)26-20(24-12)25-15-9-8-14(21)17(22)18(15)23/h3-10H,11H2,1-2H3,(H,24,25,26) |
| InChIKey | LTKNYMZEZFSAMY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|