C19H17F3N4 — CID 112917039
4-N-benzyl-4-N,6-dimethyl-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine (PubChem CID 112917039) has the molecular formula C19H17F3N4 and a molecular weight of 358.37 g/mol. Its IUPAC name is 4-N-benzyl-4-N,6-dimethyl-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-benzyl-4-N,6-dimethyl-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112917039 |
| Molecular Formula | C19H17F3N4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-N-benzyl-4-N,6-dimethyl-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(N(C)Cc2ccccc2)nc(Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C19H17F3N4/c1-12-10-16(26(2)11-13-6-4-3-5-7-13)25-19(23-12)24-15-9-8-14(20)17(21)18(15)22/h3-10H,11H2,1-2H3,(H,23,24,25) |
| InChIKey | SZDAQBVCNOZHFV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|