C12H15NO3 — CID 10933011
(4S)-4-[2-(4-methoxyphenyl)ethyl]-1,3-oxazolidin-2-one (PubChem CID 10933011) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (4S)-4-[2-(4-methoxyphenyl)ethyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-[2-(4-methoxyphenyl)ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10933011 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (4S)-4-[2-(4-methoxyphenyl)ethyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(CC[C@H]2COC(=O)N2)cc1 |
| InChI | InChI=1S/C12H15NO3/c1-15-11-6-3-9(4-7-11)2-5-10-8-16-12(14)13-10/h3-4,6-7,10H,2,5,8H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | JWJSYTVWYFGIOC-JTQLQIEISA-N |
| XLogP | 1.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |