C11H15NO4 — CID 10933145
3-methyl-5-[(E)-7-oxohept-5-enyl]-1,2,4-trioxolane-3-carbonitrile (PubChem CID 10933145) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-methyl-5-[(E)-7-oxohept-5-enyl]-1,2,4-trioxolane-3-carbonitrile.
| Compound Name | 3-methyl-5-[(E)-7-oxohept-5-enyl]-1,2,4-trioxolane-3-carbonitrile |
|---|---|
| PubChem CID | 10933145 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-methyl-5-[(E)-7-oxohept-5-enyl]-1,2,4-trioxolane-3-carbonitrile |
| SMILES | CC1(C#N)OOC(CCCC/C=C/C=O)O1 |
| InChI | InChI=1S/C11H15NO4/c1-11(9-12)14-10(15-16-11)7-5-3-2-4-6-8-13/h4,6,8,10H,2-3,5,7H2,1H3/b6-4+ |
| InChIKey | KLFKOJYILSZTTJ-GQCTYLIASA-N |
| XLogP | 1.85 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|