C9H11NO4 — CID 11127214
3-methyl-5-[(Z)-5-oxopent-3-enyl]-1,2,4-trioxolane-3-carbonitrile (PubChem CID 11127214) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-methyl-5-[(Z)-5-oxopent-3-enyl]-1,2,4-trioxolane-3-carbonitrile.
| Compound Name | 3-methyl-5-[(Z)-5-oxopent-3-enyl]-1,2,4-trioxolane-3-carbonitrile |
|---|---|
| PubChem CID | 11127214 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-methyl-5-[(Z)-5-oxopent-3-enyl]-1,2,4-trioxolane-3-carbonitrile |
| SMILES | CC1(C#N)OOC(CC/C=C\C=O)O1 |
| InChI | InChI=1S/C9H11NO4/c1-9(7-10)12-8(13-14-9)5-3-2-4-6-11/h2,4,6,8H,3,5H2,1H3/b4-2- |
| InChIKey | WOIDXIZDVVGLCG-RQOWECAXSA-N |
| XLogP | 1.07 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|