C10H13NO4 — CID 11769773
3-methyl-5-[(Z)-6-oxohex-4-enyl]-1,2,4-trioxolane-3-carbonitrile (PubChem CID 11769773) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-methyl-5-[(Z)-6-oxohex-4-enyl]-1,2,4-trioxolane-3-carbonitrile.
| Compound Name | 3-methyl-5-[(Z)-6-oxohex-4-enyl]-1,2,4-trioxolane-3-carbonitrile |
|---|---|
| PubChem CID | 11769773 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-methyl-5-[(Z)-6-oxohex-4-enyl]-1,2,4-trioxolane-3-carbonitrile |
| SMILES | CC1(C#N)OOC(CCC/C=C\C=O)O1 |
| InChI | InChI=1S/C10H13NO4/c1-10(8-11)13-9(14-15-10)6-4-2-3-5-7-12/h3,5,7,9H,2,4,6H2,1H3/b5-3- |
| InChIKey | QJUBXNSYPCOHPN-HYXAFXHYSA-N |
| XLogP | 1.46 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|