C17H20N4O4 — CID 109339389
N-cyclopropyl-6-(3,4,5-trimethoxyanilino)pyrimidine-4-carboxamide (PubChem CID 109339389) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-cyclopropyl-6-(3,4,5-trimethoxyanilino)pyrimidine-4-carboxamide.
| Compound Name | N-cyclopropyl-6-(3,4,5-trimethoxyanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109339389 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-cyclopropyl-6-(3,4,5-trimethoxyanilino)pyrimidine-4-carboxamide |
| SMILES | COc1cc(Nc2cc(C(=O)NC3CC3)ncn2)cc(OC)c1OC |
| InChI | InChI=1S/C17H20N4O4/c1-23-13-6-11(7-14(24-2)16(13)25-3)20-15-8-12(18-9-19-15)17(22)21-10-4-5-10/h6-10H,4-5H2,1-3H3,(H,21,22)(H,18,19,20) |
| InChIKey | CMRNVZFVZGHTCV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |