C12H9N5S — CID 10934073
6-phenyl-5-(1,2,4-triazol-1-yl)-1H-pyrimidine-2-thione (PubChem CID 10934073) has the molecular formula C12H9N5S and a molecular weight of 255.31 g/mol. Its IUPAC name is 6-phenyl-5-(1,2,4-triazol-1-yl)-1H-pyrimidine-2-thione.
| Compound Name | 6-phenyl-5-(1,2,4-triazol-1-yl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 10934073 |
| Molecular Formula | C12H9N5S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 6-phenyl-5-(1,2,4-triazol-1-yl)-1H-pyrimidine-2-thione |
| SMILES | S=c1ncc(-n2cncn2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C12H9N5S/c18-12-14-6-10(17-8-13-7-15-17)11(16-12)9-4-2-1-3-5-9/h1-8H,(H,14,16,18) |
| InChIKey | WIEIFQQMEHRUAB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|