C14H18O5 — CID 10934395
[(1S,3R,6R,7R,10R)-3-methoxy-9,10-dimethyl-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl] acetate (PubChem CID 10934395) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is [(1S,3R,6R,7R,10R)-3-methoxy-9,10-dimethyl-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl] acetate.
| Compound Name | [(1S,3R,6R,7R,10R)-3-methoxy-9,10-dimethyl-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl] acetate |
|---|---|
| PubChem CID | 10934395 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(1S,3R,6R,7R,10R)-3-methoxy-9,10-dimethyl-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl] acetate |
| SMILES | CO[C@]12OC[C@@H]3[C@@H](C)[C@H](C1=O)C(C)=C(OC(C)=O)[C@@H]32 |
| InChI | InChI=1S/C14H18O5/c1-6-9-5-18-14(17-4)11(9)12(19-8(3)15)7(2)10(6)13(14)16/h6,9-11H,5H2,1-4H3/t6-,9-,10+,11-,14-/m1/s1 |
| InChIKey | JQRQGNQLRSURPG-MNMNVURASA-N |
| XLogP | 1.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |