C18H20F3N5O — CID 109345359
6-(4-ethylpiperazin-1-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 109345359) has the molecular formula C18H20F3N5O and a molecular weight of 379.39 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(4-ethylpiperazin-1-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109345359 |
| Molecular Formula | C18H20F3N5O |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | CCN1CCN(c2cc(C(=O)Nc3cccc(C(F)(F)F)c3)ncn2)CC1 |
| InChI | InChI=1S/C18H20F3N5O/c1-2-25-6-8-26(9-7-25)16-11-15(22-12-23-16)17(27)24-14-5-3-4-13(10-14)18(19,20)21/h3-5,10-12H,2,6-9H2,1H3,(H,24,27) |
| InChIKey | NFGSCGAFGFTWAZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |