C10H7Cl2N3OS2 — CID 10936096
(NZ,1Z)-N-(4-chlorodithiazol-5-ylidene)-2-methoxybenzenecarbohydrazonoyl chloride (PubChem CID 10936096) has the molecular formula C10H7Cl2N3OS2 and a molecular weight of 320.23 g/mol. Its IUPAC name is (NZ,1Z)-N-(4-chlorodithiazol-5-ylidene)-2-methoxybenzenecarbohydrazonoyl chloride.
| Compound Name | (NZ,1Z)-N-(4-chlorodithiazol-5-ylidene)-2-methoxybenzenecarbohydrazonoyl chloride |
|---|---|
| PubChem CID | 10936096 |
| Molecular Formula | C10H7Cl2N3OS2 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | (NZ,1Z)-N-(4-chlorodithiazol-5-ylidene)-2-methoxybenzenecarbohydrazonoyl chloride |
| SMILES | COc1ccccc1/C(Cl)=N/N=c1\ssnc1Cl |
| InChI | InChI=1S/C10H7Cl2N3OS2/c1-16-7-5-3-2-4-6(7)8(11)13-14-10-9(12)15-18-17-10/h2-5H,1H3/b13-8-,14-10- |
| InChIKey | CLMHKIBXAJWLDM-GSPAGQKZSA-N |
| XLogP | 3.37 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|