C17H18ClF3N4O — CID 109361908
N-butyl-6-[4-chloro-3-(trifluoromethyl)anilino]-2-methylpyrimidine-4-carboxamide (PubChem CID 109361908) has the molecular formula C17H18ClF3N4O and a molecular weight of 386.81 g/mol. Its IUPAC name is N-butyl-6-[4-chloro-3-(trifluoromethyl)anilino]-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-butyl-6-[4-chloro-3-(trifluoromethyl)anilino]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109361908 |
| Molecular Formula | C17H18ClF3N4O |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-butyl-6-[4-chloro-3-(trifluoromethyl)anilino]-2-methylpyrimidine-4-carboxamide |
| SMILES | CCCCNC(=O)c1cc(Nc2ccc(Cl)c(C(F)(F)F)c2)nc(C)n1 |
| InChI | InChI=1S/C17H18ClF3N4O/c1-3-4-7-22-16(26)14-9-15(24-10(2)23-14)25-11-5-6-13(18)12(8-11)17(19,20)21/h5-6,8-9H,3-4,7H2,1-2H3,(H,22,26)(H,23,24,25) |
| InChIKey | VDJOBPYBQFWSTN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|