C20H28N4O — CID 109362417
6-(butan-2-ylamino)-N-(4-tert-butylphenyl)-2-methylpyrimidine-4-carboxamide (PubChem CID 109362417) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 6-(butan-2-ylamino)-N-(4-tert-butylphenyl)-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-(butan-2-ylamino)-N-(4-tert-butylphenyl)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109362417 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 6-(butan-2-ylamino)-N-(4-tert-butylphenyl)-2-methylpyrimidine-4-carboxamide |
| SMILES | CCC(C)Nc1cc(C(=O)Nc2ccc(C(C)(C)C)cc2)nc(C)n1 |
| InChI | InChI=1S/C20H28N4O/c1-7-13(2)21-18-12-17(22-14(3)23-18)19(25)24-16-10-8-15(9-11-16)20(4,5)6/h8-13H,7H2,1-6H3,(H,24,25)(H,21,22,23) |
| InChIKey | TWPCXYOQDRUYFA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |