C18H23NO5 — CID 10936527
3a-O-benzyl 3-O-ethyl (2R,3S,3aR)-2-methyl-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3,3a-dicarboxylate (PubChem CID 10936527) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 3a-O-benzyl 3-O-ethyl (2R,3S,3aR)-2-methyl-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3,3a-dicarboxylate.
| Compound Name | 3a-O-benzyl 3-O-ethyl (2R,3S,3aR)-2-methyl-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3,3a-dicarboxylate |
|---|---|
| PubChem CID | 10936527 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3a-O-benzyl 3-O-ethyl (2R,3S,3aR)-2-methyl-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3,3a-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C)ON2CCC[C@]12C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO5/c1-3-22-16(20)15-13(2)24-19-11-7-10-18(15,19)17(21)23-12-14-8-5-4-6-9-14/h4-6,8-9,13,15H,3,7,10-12H2,1-2H3/t13-,15+,18-/m1/s1 |
| InChIKey | FNKMMPGBYAQSRV-QIIPPGSGSA-N |
| XLogP | 2.08 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |